C18H19N7O7 — CID 17083991
3-(3,4-dimethoxyphenyl)-N-[2-[[2-(4-nitropyrazol-1-yl)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17083991) has the molecular formula C18H19N7O7 and a molecular weight of 445.39 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[2-[[2-(4-nitropyrazol-1-yl)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[2-[[2-(4-nitropyrazol-1-yl)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17083991 |
| Molecular Formula | C18H19N7O7 |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[2-[[2-(4-nitropyrazol-1-yl)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | COc1ccc(-c2noc(C(=O)NCCNC(=O)Cn3cc([N+](=O)[O-])cn3)n2)cc1OC |
| InChI | InChI=1S/C18H19N7O7/c1-30-13-4-3-11(7-14(13)31-2)16-22-18(32-23-16)17(27)20-6-5-19-15(26)10-24-9-12(8-21-24)25(28)29/h3-4,7-9H,5-6,10H2,1-2H3,(H,19,26)(H,20,27) |
| InChIKey | SHBWZMWPRPABDQ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 176.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|