C19H16N6O7 — CID 17083765
3-(3-nitrophenyl)-N-[2-[[2-(4-nitrophenyl)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17083765) has the molecular formula C19H16N6O7 and a molecular weight of 440.37 g/mol. Its IUPAC name is 3-(3-nitrophenyl)-N-[2-[[2-(4-nitrophenyl)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-(3-nitrophenyl)-N-[2-[[2-(4-nitrophenyl)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17083765 |
| Molecular Formula | C19H16N6O7 |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 3-(3-nitrophenyl)-N-[2-[[2-(4-nitrophenyl)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)NCCNC(=O)c1nc(-c2cccc([N+](=O)[O-])c2)no1 |
| InChI | InChI=1S/C19H16N6O7/c26-16(10-12-4-6-14(7-5-12)24(28)29)20-8-9-21-18(27)19-22-17(23-32-19)13-2-1-3-15(11-13)25(30)31/h1-7,11H,8-10H2,(H,20,26)(H,21,27) |
| InChIKey | VICQVQXKFRLRKV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 183.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|