C16H12N4O4 — CID 91635012
N-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]benzamide (PubChem CID 91635012) has the molecular formula C16H12N4O4 and a molecular weight of 324.30 g/mol. Its IUPAC name is N-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]benzamide.
| Compound Name | N-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]benzamide |
|---|---|
| PubChem CID | 91635012 |
| Molecular Formula | C16H12N4O4 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | N-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]benzamide |
| SMILES | O=C(NCc1nc(-c2cccc([N+](=O)[O-])c2)no1)c1ccccc1 |
| InChI | InChI=1S/C16H12N4O4/c21-16(11-5-2-1-3-6-11)17-10-14-18-15(19-24-14)12-7-4-8-13(9-12)20(22)23/h1-9H,10H2,(H,17,21) |
| InChIKey | YJHYUDBDHVYVJF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|