C17H13N3O3S — CID 17163934
3-nitro-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]benzamide (PubChem CID 17163934) has the molecular formula C17H13N3O3S and a molecular weight of 339.38 g/mol. Its IUPAC name is 3-nitro-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]benzamide.
| Compound Name | 3-nitro-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 17163934 |
| Molecular Formula | C17H13N3O3S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 3-nitro-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]benzamide |
| SMILES | O=C(NCc1csc(-c2ccccc2)n1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H13N3O3S/c21-16(13-7-4-8-15(9-13)20(22)23)18-10-14-11-24-17(19-14)12-5-2-1-3-6-12/h1-9,11H,10H2,(H,18,21) |
| InChIKey | OFTIZKLCROKXHM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|