C18H16N4O6 — CID 99994996
N-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-nitrobenzamide (PubChem CID 99994996) has the molecular formula C18H16N4O6 and a molecular weight of 384.35 g/mol. Its IUPAC name is N-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-nitrobenzamide.
| Compound Name | N-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 99994996 |
| Molecular Formula | C18H16N4O6 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | N-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-nitrobenzamide |
| SMILES | COc1ccc(-c2noc(CNC(=O)c3cccc([N+](=O)[O-])c3)n2)c(OC)c1 |
| InChI | InChI=1S/C18H16N4O6/c1-26-13-6-7-14(15(9-13)27-2)17-20-16(28-21-17)10-19-18(23)11-4-3-5-12(8-11)22(24)25/h3-9H,10H2,1-2H3,(H,19,23) |
| InChIKey | HMGBGTGMRKVRKH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|