C17H13FN4O4 — CID 51064745
N-[2-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-nitrobenzamide (PubChem CID 51064745) has the molecular formula C17H13FN4O4 and a molecular weight of 356.31 g/mol. Its IUPAC name is N-[2-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-nitrobenzamide.
| Compound Name | N-[2-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 51064745 |
| Molecular Formula | C17H13FN4O4 |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | N-[2-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-nitrobenzamide |
| SMILES | O=C(NCCc1nc(-c2ccc(F)cc2)no1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H13FN4O4/c18-13-6-4-11(5-7-13)16-20-15(26-21-16)8-9-19-17(23)12-2-1-3-14(10-12)22(24)25/h1-7,10H,8-9H2,(H,19,23) |
| InChIKey | MOUHMVAUYVFGKO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|