C20H19FN4O4 — CID 55877491
4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-[1-(3-nitrophenyl)ethyl]butanamide (PubChem CID 55877491) has the molecular formula C20H19FN4O4 and a molecular weight of 398.39 g/mol. Its IUPAC name is 4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-[1-(3-nitrophenyl)ethyl]butanamide.
| Compound Name | 4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-[1-(3-nitrophenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 55877491 |
| Molecular Formula | C20H19FN4O4 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-[1-(3-nitrophenyl)ethyl]butanamide |
| SMILES | CC(NC(=O)CCCc1nc(-c2ccc(F)cc2)no1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H19FN4O4/c1-13(15-4-2-5-17(12-15)25(27)28)22-18(26)6-3-7-19-23-20(24-29-19)14-8-10-16(21)11-9-14/h2,4-5,8-13H,3,6-7H2,1H3,(H,22,26) |
| InChIKey | CECZYOSSULXRKE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|