C20H22N4O4S — CID 42921804
4-(3-phenyl-1,2,4-oxadiazol-5-yl)-N-[1-(3-sulfamoylphenyl)ethyl]butanamide (PubChem CID 42921804) has the molecular formula C20H22N4O4S and a molecular weight of 414.49 g/mol. Its IUPAC name is 4-(3-phenyl-1,2,4-oxadiazol-5-yl)-N-[1-(3-sulfamoylphenyl)ethyl]butanamide.
| Compound Name | 4-(3-phenyl-1,2,4-oxadiazol-5-yl)-N-[1-(3-sulfamoylphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 42921804 |
| Molecular Formula | C20H22N4O4S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 4-(3-phenyl-1,2,4-oxadiazol-5-yl)-N-[1-(3-sulfamoylphenyl)ethyl]butanamide |
| SMILES | CC(NC(=O)CCCc1nc(-c2ccccc2)no1)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C20H22N4O4S/c1-14(16-9-5-10-17(13-16)29(21,26)27)22-18(25)11-6-12-19-23-20(24-28-19)15-7-3-2-4-8-15/h2-5,7-10,13-14H,6,11-12H2,1H3,(H,22,25)(H2,21,26,27) |
| InChIKey | JDEGXNUBIHIYEJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |