C18H14N4O6 — CID 83290008
N-[2-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]ethyl]-3-nitrobenzamide (PubChem CID 83290008) has the molecular formula C18H14N4O6 and a molecular weight of 382.33 g/mol. Its IUPAC name is N-[2-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]ethyl]-3-nitrobenzamide.
| Compound Name | N-[2-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]ethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 83290008 |
| Molecular Formula | C18H14N4O6 |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | N-[2-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]ethyl]-3-nitrobenzamide |
| SMILES | O=C(NCCc1nc(-c2ccc3c(c2)OCO3)no1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H14N4O6/c23-18(12-2-1-3-13(8-12)22(24)25)19-7-6-16-20-17(21-28-16)11-4-5-14-15(9-11)27-10-26-14/h1-5,8-9H,6-7,10H2,(H,19,23) |
| InChIKey | FVKHEKDKZLPJEV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|