C17H16N2O5 — CID 86060341
N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-(3-nitrophenyl)acetamide (PubChem CID 86060341) has the molecular formula C17H16N2O5 and a molecular weight of 328.32 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-(3-nitrophenyl)acetamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 86060341 |
| Molecular Formula | C17H16N2O5 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-(3-nitrophenyl)acetamide |
| SMILES | O=C(Cc1cccc([N+](=O)[O-])c1)NCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H16N2O5/c20-17(10-13-2-1-3-14(8-13)19(21)22)18-7-6-12-4-5-15-16(9-12)24-11-23-15/h1-5,8-9H,6-7,10-11H2,(H,18,20) |
| InChIKey | BLQFCSFVUZCZFV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|