C16H13N3O7 — CID 3270500
N-(1,3-benzodioxol-5-ylmethyl)-2-(2,4-dinitrophenyl)acetamide (PubChem CID 3270500) has the molecular formula C16H13N3O7 and a molecular weight of 359.29 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-(2,4-dinitrophenyl)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(2,4-dinitrophenyl)acetamide |
|---|---|
| PubChem CID | 3270500 |
| Molecular Formula | C16H13N3O7 |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(2,4-dinitrophenyl)acetamide |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H13N3O7/c20-16(17-8-10-1-4-14-15(5-10)26-9-25-14)6-11-2-3-12(18(21)22)7-13(11)19(23)24/h1-5,7H,6,8-9H2,(H,17,20) |
| InChIKey | ZGPJTBTUJLKYJX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 133.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|