C15H14N4O4S — CID 8628054
1-(4-amino-3-nitrophenyl)-3-(1,3-benzodioxol-5-ylmethyl)thiourea (PubChem CID 8628054) has the molecular formula C15H14N4O4S and a molecular weight of 346.37 g/mol. Its IUPAC name is 1-(4-amino-3-nitrophenyl)-3-(1,3-benzodioxol-5-ylmethyl)thiourea.
| Compound Name | 1-(4-amino-3-nitrophenyl)-3-(1,3-benzodioxol-5-ylmethyl)thiourea |
|---|---|
| PubChem CID | 8628054 |
| Molecular Formula | C15H14N4O4S |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 1-(4-amino-3-nitrophenyl)-3-(1,3-benzodioxol-5-ylmethyl)thiourea |
| SMILES | Nc1ccc(NC(=S)NCc2ccc3c(c2)OCO3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H14N4O4S/c16-11-3-2-10(6-12(11)19(20)21)18-15(24)17-7-9-1-4-13-14(5-9)23-8-22-13/h1-6H,7-8,16H2,(H2,17,18,24) |
| InChIKey | ALTPFHGRGUXETM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|