C19H22N2O2S — CID 2193473
1-(1,3-benzodioxol-5-ylmethyl)-3-(4-butylphenyl)thiourea (PubChem CID 2193473) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-(4-butylphenyl)thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(4-butylphenyl)thiourea |
|---|---|
| PubChem CID | 2193473 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(4-butylphenyl)thiourea |
| SMILES | CCCCc1ccc(NC(=S)NCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C19H22N2O2S/c1-2-3-4-14-5-8-16(9-6-14)21-19(24)20-12-15-7-10-17-18(11-15)23-13-22-17/h5-11H,2-4,12-13H2,1H3,(H2,20,21,24) |
| InChIKey | CVZCIKYRMHJVSS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|