C17H19N3O2S — CID 8786429
1-(1,3-benzodioxol-5-ylmethyl)-3-(3,5-dimethylanilino)thiourea (PubChem CID 8786429) has the molecular formula C17H19N3O2S and a molecular weight of 329.43 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-(3,5-dimethylanilino)thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(3,5-dimethylanilino)thiourea |
|---|---|
| PubChem CID | 8786429 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(3,5-dimethylanilino)thiourea |
| SMILES | Cc1cc(C)cc(NNC(=S)NCc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C17H19N3O2S/c1-11-5-12(2)7-14(6-11)19-20-17(23)18-9-13-3-4-15-16(8-13)22-10-21-15/h3-8,19H,9-10H2,1-2H3,(H2,18,20,23) |
| InChIKey | XTENALQCJVMKAK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 54.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|