C16H24N2O3S — CID 8624723
1-(1,3-benzodioxol-5-ylmethyl)-3-(3-butoxypropyl)thiourea (PubChem CID 8624723) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-(3-butoxypropyl)thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(3-butoxypropyl)thiourea |
|---|---|
| PubChem CID | 8624723 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(3-butoxypropyl)thiourea |
| SMILES | CCCCOCCCNC(=S)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H24N2O3S/c1-2-3-8-19-9-4-7-17-16(22)18-11-13-5-6-14-15(10-13)21-12-20-14/h5-6,10H,2-4,7-9,11-12H2,1H3,(H2,17,18,22) |
| InChIKey | FAXMETDUWXXPEE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|