C15H23NO4 — CID 107262785
1-(1,3-benzodioxol-5-ylmethylamino)-3-butoxypropan-2-ol (PubChem CID 107262785) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethylamino)-3-butoxypropan-2-ol.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethylamino)-3-butoxypropan-2-ol |
|---|---|
| PubChem CID | 107262785 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethylamino)-3-butoxypropan-2-ol |
| SMILES | CCCCOCC(O)CNCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H23NO4/c1-2-3-6-18-10-13(17)9-16-8-12-4-5-14-15(7-12)20-11-19-14/h4-5,7,13,16-17H,2-3,6,8-11H2,1H3 |
| InChIKey | ZXTUGZXGGAWJKU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|