C20H26N3O2S+ — CID 9284259
3-(1,3-benzodioxol-5-ylmethylcarbamothioylamino)propyl-benzyl-methylazanium (PubChem CID 9284259) has the molecular formula C20H26N3O2S+ and a molecular weight of 372.51 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethylcarbamothioylamino)propyl-benzyl-methylazanium.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethylcarbamothioylamino)propyl-benzyl-methylazanium |
|---|---|
| PubChem CID | 9284259 |
| Molecular Formula | C20H26N3O2S+ |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethylcarbamothioylamino)propyl-benzyl-methylazanium |
| SMILES | C[NH+](CCCNC(=S)NCc1ccc2c(c1)OCO2)Cc1ccccc1 |
| InChI | InChI=1S/C20H25N3O2S/c1-23(14-16-6-3-2-4-7-16)11-5-10-21-20(26)22-13-17-8-9-18-19(12-17)25-15-24-18/h2-4,6-9,12H,5,10-11,13-15H2,1H3,(H2,21,22,26)/p+1 |
| InChIKey | CRTMWOHMNQUYSP-UHFFFAOYSA-O |
| XLogP | 1.48 |
| TPSA | 46.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|