C18H20N2O2S — CID 9231864
3-(1,3-benzodioxol-5-ylmethyl)-1-methyl-1-[(1R)-1-phenylethyl]thiourea (PubChem CID 9231864) has the molecular formula C18H20N2O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethyl)-1-methyl-1-[(1R)-1-phenylethyl]thiourea.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethyl)-1-methyl-1-[(1R)-1-phenylethyl]thiourea |
|---|---|
| PubChem CID | 9231864 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethyl)-1-methyl-1-[(1R)-1-phenylethyl]thiourea |
| SMILES | C[C@H](c1ccccc1)N(C)C(=S)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H20N2O2S/c1-13(15-6-4-3-5-7-15)20(2)18(23)19-11-14-8-9-16-17(10-14)22-12-21-16/h3-10,13H,11-12H2,1-2H3,(H,19,23)/t13-/m1/s1 |
| InChIKey | HVAWQKVGXGIOMZ-CYBMUJFWSA-N |
| XLogP | 3.48 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|