C17H17ClN2O2S — CID 8676137
1-(1,3-benzodioxol-5-ylmethyl)-3-[(1S)-1-(3-chlorophenyl)ethyl]thiourea (PubChem CID 8676137) has the molecular formula C17H17ClN2O2S and a molecular weight of 348.86 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[(1S)-1-(3-chlorophenyl)ethyl]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(1S)-1-(3-chlorophenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 8676137 |
| Molecular Formula | C17H17ClN2O2S |
| Molecular Weight | 348.86 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(1S)-1-(3-chlorophenyl)ethyl]thiourea |
| SMILES | C[C@H](NC(=S)NCc1ccc2c(c1)OCO2)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H17ClN2O2S/c1-11(13-3-2-4-14(18)8-13)20-17(23)19-9-12-5-6-15-16(7-12)22-10-21-15/h2-8,11H,9-10H2,1H3,(H2,19,20,23)/t11-/m0/s1 |
| InChIKey | UPBZRSLJWGHSMY-NSHDSACASA-N |
| XLogP | 3.79 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.86 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|