C17H16F2N2O3 — CID 27516317
1-(1,3-benzodioxol-5-ylmethyl)-3-[(1R)-1-(3,4-difluorophenyl)ethyl]urea (PubChem CID 27516317) has the molecular formula C17H16F2N2O3 and a molecular weight of 334.32 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[(1R)-1-(3,4-difluorophenyl)ethyl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(1R)-1-(3,4-difluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 27516317 |
| Molecular Formula | C17H16F2N2O3 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(1R)-1-(3,4-difluorophenyl)ethyl]urea |
| SMILES | C[C@@H](NC(=O)NCc1ccc2c(c1)OCO2)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H16F2N2O3/c1-10(12-3-4-13(18)14(19)7-12)21-17(22)20-8-11-2-5-15-16(6-11)24-9-23-15/h2-7,10H,8-9H2,1H3,(H2,20,21,22)/t10-/m1/s1 |
| InChIKey | MKUNLNAXOWJYSD-SNVBAGLBSA-N |
| XLogP | 3.25 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |