C18H15F2NO3 — CID 43010635
(E)-3-(1,3-benzodioxol-5-yl)-N-[1-(3,4-difluorophenyl)ethyl]prop-2-enamide (PubChem CID 43010635) has the molecular formula C18H15F2NO3 and a molecular weight of 331.32 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-[1-(3,4-difluorophenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[1-(3,4-difluorophenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 43010635 |
| Molecular Formula | C18H15F2NO3 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[1-(3,4-difluorophenyl)ethyl]prop-2-enamide |
| SMILES | CC(NC(=O)/C=C/c1ccc2c(c1)OCO2)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H15F2NO3/c1-11(13-4-5-14(19)15(20)9-13)21-18(22)7-3-12-2-6-16-17(8-12)24-10-23-16/h2-9,11H,10H2,1H3,(H,21,22)/b7-3+ |
| InChIKey | YMNOFESKHBLFSV-XVNBXDOJSA-N |
| XLogP | 3.58 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|