C24H28N2O3 — CID 99997190
(E)-3-(1,3-benzodioxol-5-yl)-N-[(1R)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]prop-2-enamide (PubChem CID 99997190) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-[(1R)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[(1R)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 99997190 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[(1R)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]prop-2-enamide |
| SMILES | C[C@@H]1CCCN(c2ccc([C@@H](C)NC(=O)/C=C/c3ccc4c(c3)OCO4)cc2)C1 |
| InChI | InChI=1S/C24H28N2O3/c1-17-4-3-13-26(15-17)21-9-7-20(8-10-21)18(2)25-24(27)12-6-19-5-11-22-23(14-19)29-16-28-22/h5-12,14,17-18H,3-4,13,15-16H2,1-2H3,(H,25,27)/b12-6+/t17-,18-/m1/s1 |
| InChIKey | JRAKZVQEXSSXMO-PFKFJBCPSA-N |
| XLogP | 4.54 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|