C27H36N2O — CID 125042497
(E)-3-(4-tert-butylphenyl)-N-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]prop-2-enamide (PubChem CID 125042497) has the molecular formula C27H36N2O and a molecular weight of 404.60 g/mol. Its IUPAC name is (E)-3-(4-tert-butylphenyl)-N-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(4-tert-butylphenyl)-N-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 125042497 |
| Molecular Formula | C27H36N2O |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | (E)-3-(4-tert-butylphenyl)-N-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]prop-2-enamide |
| SMILES | C[C@H]1CCCN(c2ccc([C@@H](C)NC(=O)/C=C/c3ccc(C(C)(C)C)cc3)cc2)C1 |
| InChI | InChI=1S/C27H36N2O/c1-20-7-6-18-29(19-20)25-15-11-23(12-16-25)21(2)28-26(30)17-10-22-8-13-24(14-9-22)27(3,4)5/h8-17,20-21H,6-7,18-19H2,1-5H3,(H,28,30)/b17-10+/t20-,21+/m0/s1 |
| InChIKey | IPJAAONCUVKVIL-HGNCSYERSA-N |
| XLogP | 6.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|