C23H29NO — CID 94843392
(E)-3-(4-tert-butylphenyl)-N-[(1R)-1-(3,4-dimethylphenyl)ethyl]prop-2-enamide (PubChem CID 94843392) has the molecular formula C23H29NO and a molecular weight of 335.49 g/mol. Its IUPAC name is (E)-3-(4-tert-butylphenyl)-N-[(1R)-1-(3,4-dimethylphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(4-tert-butylphenyl)-N-[(1R)-1-(3,4-dimethylphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 94843392 |
| Molecular Formula | C23H29NO |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | (E)-3-(4-tert-butylphenyl)-N-[(1R)-1-(3,4-dimethylphenyl)ethyl]prop-2-enamide |
| SMILES | Cc1ccc([C@@H](C)NC(=O)/C=C/c2ccc(C(C)(C)C)cc2)cc1C |
| InChI | InChI=1S/C23H29NO/c1-16-7-11-20(15-17(16)2)18(3)24-22(25)14-10-19-8-12-21(13-9-19)23(4,5)6/h7-15,18H,1-6H3,(H,24,25)/b14-10+/t18-/m1/s1 |
| InChIKey | HWLPSQDQXJVWJT-PMXLPMHFSA-N |
| XLogP | 5.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|