C24H31NO2 — CID 133209856
(E)-3-(4-tert-butylphenyl)-N-[1-(4-methoxy-3-methylphenyl)propyl]prop-2-enamide (PubChem CID 133209856) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is (E)-3-(4-tert-butylphenyl)-N-[1-(4-methoxy-3-methylphenyl)propyl]prop-2-enamide.
| Compound Name | (E)-3-(4-tert-butylphenyl)-N-[1-(4-methoxy-3-methylphenyl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 133209856 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | (E)-3-(4-tert-butylphenyl)-N-[1-(4-methoxy-3-methylphenyl)propyl]prop-2-enamide |
| SMILES | CCC(NC(=O)/C=C/c1ccc(C(C)(C)C)cc1)c1ccc(OC)c(C)c1 |
| InChI | InChI=1S/C24H31NO2/c1-7-21(19-11-14-22(27-6)17(2)16-19)25-23(26)15-10-18-8-12-20(13-9-18)24(3,4)5/h8-16,21H,7H2,1-6H3,(H,25,26)/b15-10+ |
| InChIKey | KIXMGSPOHYDLOO-XNTDXEJSSA-N |
| XLogP | 5.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|