C20H22FNO — CID 99996485
(E)-N-[(1S)-1-(3,4-dimethylphenyl)propyl]-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 99996485) has the molecular formula C20H22FNO and a molecular weight of 311.40 g/mol. Its IUPAC name is (E)-N-[(1S)-1-(3,4-dimethylphenyl)propyl]-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[(1S)-1-(3,4-dimethylphenyl)propyl]-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 99996485 |
| Molecular Formula | C20H22FNO |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | (E)-N-[(1S)-1-(3,4-dimethylphenyl)propyl]-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | CC[C@H](NC(=O)/C=C/c1ccc(F)cc1)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C20H22FNO/c1-4-19(17-9-5-14(2)15(3)13-17)22-20(23)12-8-16-6-10-18(21)11-7-16/h5-13,19H,4H2,1-3H3,(H,22,23)/b12-8+/t19-/m0/s1 |
| InChIKey | BVPZVRCDSWOJAL-BEBFYNPSSA-N |
| XLogP | 4.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|