C28H27NO3 — CID 160591430
[(2S)-2-(3,4-dimethylphenyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]ethyl] (E)-3-phenylprop-2-enoate (PubChem CID 160591430) has the molecular formula C28H27NO3 and a molecular weight of 425.53 g/mol. Its IUPAC name is [(2S)-2-(3,4-dimethylphenyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]ethyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(2S)-2-(3,4-dimethylphenyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]ethyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 160591430 |
| Molecular Formula | C28H27NO3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | [(2S)-2-(3,4-dimethylphenyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]ethyl] (E)-3-phenylprop-2-enoate |
| SMILES | Cc1ccc([C@@H](COC(=O)/C=C/c2ccccc2)NC(=O)/C=C/c2ccccc2)cc1C |
| InChI | InChI=1S/C28H27NO3/c1-21-13-16-25(19-22(21)2)26(29-27(30)17-14-23-9-5-3-6-10-23)20-32-28(31)18-15-24-11-7-4-8-12-24/h3-19,26H,20H2,1-2H3,(H,29,30)/b17-14+,18-15+/t26-/m1/s1 |
| InChIKey | RDBNUCHJEHNJJG-NRUYAYGGSA-N |
| XLogP | 5.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|