C21H23NO3 — CID 7852887
[2-[[(1S)-1-(4-methylphenyl)propyl]amino]-2-oxoethyl] (E)-3-phenylprop-2-enoate (PubChem CID 7852887) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is [2-[[(1S)-1-(4-methylphenyl)propyl]amino]-2-oxoethyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [2-[[(1S)-1-(4-methylphenyl)propyl]amino]-2-oxoethyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 7852887 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | [2-[[(1S)-1-(4-methylphenyl)propyl]amino]-2-oxoethyl] (E)-3-phenylprop-2-enoate |
| SMILES | CC[C@H](NC(=O)COC(=O)/C=C/c1ccccc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H23NO3/c1-3-19(18-12-9-16(2)10-13-18)22-20(23)15-25-21(24)14-11-17-7-5-4-6-8-17/h4-14,19H,3,15H2,1-2H3,(H,22,23)/b14-11+/t19-/m0/s1 |
| InChIKey | JRENINGXJIIVFP-VUVZNRFTSA-N |
| XLogP | 3.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|