C19H19Cl2NO — CID 94843398
(E)-3-(2,4-dichlorophenyl)-N-[(1R)-1-(3,4-dimethylphenyl)ethyl]prop-2-enamide (PubChem CID 94843398) has the molecular formula C19H19Cl2NO and a molecular weight of 348.27 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-[(1R)-1-(3,4-dimethylphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-[(1R)-1-(3,4-dimethylphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 94843398 |
| Molecular Formula | C19H19Cl2NO |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-[(1R)-1-(3,4-dimethylphenyl)ethyl]prop-2-enamide |
| SMILES | Cc1ccc([C@@H](C)NC(=O)/C=C/c2ccc(Cl)cc2Cl)cc1C |
| InChI | InChI=1S/C19H19Cl2NO/c1-12-4-5-16(10-13(12)2)14(3)22-19(23)9-7-15-6-8-17(20)11-18(15)21/h4-11,14H,1-3H3,(H,22,23)/b9-7+/t14-/m1/s1 |
| InChIKey | JWGBEJABSHEJQP-RCQQVGEISA-N |
| XLogP | 5.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|