C19H19Cl2NO2 — CID 99996229
(E)-3-(2,4-dichlorophenyl)-N-[(2R)-1-(2-methylphenoxy)propan-2-yl]prop-2-enamide (PubChem CID 99996229) has the molecular formula C19H19Cl2NO2 and a molecular weight of 364.27 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-[(2R)-1-(2-methylphenoxy)propan-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-[(2R)-1-(2-methylphenoxy)propan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 99996229 |
| Molecular Formula | C19H19Cl2NO2 |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-[(2R)-1-(2-methylphenoxy)propan-2-yl]prop-2-enamide |
| SMILES | Cc1ccccc1OC[C@@H](C)NC(=O)/C=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H19Cl2NO2/c1-13-5-3-4-6-18(13)24-12-14(2)22-19(23)10-8-15-7-9-16(20)11-17(15)21/h3-11,14H,12H2,1-2H3,(H,22,23)/b10-8+/t14-/m1/s1 |
| InChIKey | VIYUOXOWCSKRHB-QSYFUGGGSA-N |
| XLogP | 4.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|