C16H17Cl2NO5 — CID 33239901
diethyl 2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]propanedioate (PubChem CID 33239901) has the molecular formula C16H17Cl2NO5 and a molecular weight of 374.22 g/mol. Its IUPAC name is diethyl 2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]propanedioate.
| Compound Name | diethyl 2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]propanedioate |
|---|---|
| PubChem CID | 33239901 |
| Molecular Formula | C16H17Cl2NO5 |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | diethyl 2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]propanedioate |
| SMILES | CCOC(=O)C(NC(=O)/C=C/c1ccc(Cl)cc1Cl)C(=O)OCC |
| InChI | InChI=1S/C16H17Cl2NO5/c1-3-23-15(21)14(16(22)24-4-2)19-13(20)8-6-10-5-7-11(17)9-12(10)18/h5-9,14H,3-4H2,1-2H3,(H,19,20)/b8-6+ |
| InChIKey | NFSWTQPJWNNCNK-SOFGYWHQSA-N |
| XLogP | 2.62 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|