C16H18BrNO5 — CID 25474462
diethyl 2-[[(E)-3-(2-bromophenyl)prop-2-enoyl]amino]propanedioate (PubChem CID 25474462) has the molecular formula C16H18BrNO5 and a molecular weight of 384.23 g/mol. Its IUPAC name is diethyl 2-[[(E)-3-(2-bromophenyl)prop-2-enoyl]amino]propanedioate.
| Compound Name | diethyl 2-[[(E)-3-(2-bromophenyl)prop-2-enoyl]amino]propanedioate |
|---|---|
| PubChem CID | 25474462 |
| Molecular Formula | C16H18BrNO5 |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | diethyl 2-[[(E)-3-(2-bromophenyl)prop-2-enoyl]amino]propanedioate |
| SMILES | CCOC(=O)C(NC(=O)/C=C/c1ccccc1Br)C(=O)OCC |
| InChI | InChI=1S/C16H18BrNO5/c1-3-22-15(20)14(16(21)23-4-2)18-13(19)10-9-11-7-5-6-8-12(11)17/h5-10,14H,3-4H2,1-2H3,(H,18,19)/b10-9+ |
| InChIKey | VKJDGFBGZOGXKQ-MDZDMXLPSA-N |
| XLogP | 2.07 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|