C18H25BrN2O3 — CID 55645248
ethyl N-[1-[[(E)-3-(2-bromophenyl)prop-2-enoyl]amino]-4-methylpentan-2-yl]carbamate (PubChem CID 55645248) has the molecular formula C18H25BrN2O3 and a molecular weight of 397.31 g/mol. Its IUPAC name is ethyl N-[1-[[(E)-3-(2-bromophenyl)prop-2-enoyl]amino]-4-methylpentan-2-yl]carbamate.
| Compound Name | ethyl N-[1-[[(E)-3-(2-bromophenyl)prop-2-enoyl]amino]-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 55645248 |
| Molecular Formula | C18H25BrN2O3 |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | ethyl N-[1-[[(E)-3-(2-bromophenyl)prop-2-enoyl]amino]-4-methylpentan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(CNC(=O)/C=C/c1ccccc1Br)CC(C)C |
| InChI | InChI=1S/C18H25BrN2O3/c1-4-24-18(23)21-15(11-13(2)3)12-20-17(22)10-9-14-7-5-6-8-16(14)19/h5-10,13,15H,4,11-12H2,1-3H3,(H,20,22)(H,21,23)/b10-9+ |
| InChIKey | RZGKIVFFUCJDJI-MDZDMXLPSA-N |
| XLogP | 3.74 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|