C13H14BrNO4 — CID 103879637
methyl 3-[[(E)-3-(2-bromophenyl)prop-2-enoyl]amino]-2-hydroxypropanoate (PubChem CID 103879637) has the molecular formula C13H14BrNO4 and a molecular weight of 328.16 g/mol. Its IUPAC name is methyl 3-[[(E)-3-(2-bromophenyl)prop-2-enoyl]amino]-2-hydroxypropanoate.
| Compound Name | methyl 3-[[(E)-3-(2-bromophenyl)prop-2-enoyl]amino]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 103879637 |
| Molecular Formula | C13H14BrNO4 |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | methyl 3-[[(E)-3-(2-bromophenyl)prop-2-enoyl]amino]-2-hydroxypropanoate |
| SMILES | COC(=O)C(O)CNC(=O)/C=C/c1ccccc1Br |
| InChI | InChI=1S/C13H14BrNO4/c1-19-13(18)11(16)8-15-12(17)7-6-9-4-2-3-5-10(9)14/h2-7,11,16H,8H2,1H3,(H,15,17)/b7-6+ |
| InChIKey | WASOBJRMZTXQLJ-VOTSOKGWSA-N |
| XLogP | 1.11 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|