C13H15BrN2O3 — CID 106164334
3-[[(E)-3-(2-bromo-4-methylphenyl)prop-2-enoyl]amino]-2-hydroxypropanamide (PubChem CID 106164334) has the molecular formula C13H15BrN2O3 and a molecular weight of 327.18 g/mol. Its IUPAC name is 3-[[(E)-3-(2-bromo-4-methylphenyl)prop-2-enoyl]amino]-2-hydroxypropanamide.
| Compound Name | 3-[[(E)-3-(2-bromo-4-methylphenyl)prop-2-enoyl]amino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106164334 |
| Molecular Formula | C13H15BrN2O3 |
| Molecular Weight | 327.18 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 3-[[(E)-3-(2-bromo-4-methylphenyl)prop-2-enoyl]amino]-2-hydroxypropanamide |
| SMILES | Cc1ccc(/C=C/C(=O)NCC(O)C(N)=O)c(Br)c1 |
| InChI | InChI=1S/C13H15BrN2O3/c1-8-2-3-9(10(14)6-8)4-5-12(18)16-7-11(17)13(15)19/h2-6,11,17H,7H2,1H3,(H2,15,19)(H,16,18)/b5-4+ |
| InChIKey | FAVWKYAQUDXCAO-SNAWJCMRSA-N |
| XLogP | 0.73 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.18 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|