C13H14BrNO3 — CID 54991128
(2R)-2-[[(E)-3-(2-bromo-4-methylphenyl)prop-2-enoyl]amino]propanoic acid (PubChem CID 54991128) has the molecular formula C13H14BrNO3 and a molecular weight of 312.16 g/mol. Its IUPAC name is (2R)-2-[[(E)-3-(2-bromo-4-methylphenyl)prop-2-enoyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[(E)-3-(2-bromo-4-methylphenyl)prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 54991128 |
| Molecular Formula | C13H14BrNO3 |
| Molecular Weight | 312.16 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | (2R)-2-[[(E)-3-(2-bromo-4-methylphenyl)prop-2-enoyl]amino]propanoic acid |
| SMILES | Cc1ccc(/C=C/C(=O)N[C@H](C)C(=O)O)c(Br)c1 |
| InChI | InChI=1S/C13H14BrNO3/c1-8-3-4-10(11(14)7-8)5-6-12(16)15-9(2)13(17)18/h3-7,9H,1-2H3,(H,15,16)(H,17,18)/b6-5+/t9-/m1/s1 |
| InChIKey | JOLXMJFUXBAPTG-VUHVRTRXSA-N |
| XLogP | 2.36 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.16 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|