C12H12FNO3 — CID 78972924
(2R)-2-[3-(2-fluorophenyl)prop-2-enoylamino]propanoic acid (PubChem CID 78972924) has the molecular formula C12H12FNO3 and a molecular weight of 237.23 g/mol. Its IUPAC name is (2R)-2-[3-(2-fluorophenyl)prop-2-enoylamino]propanoic acid.
| Compound Name | (2R)-2-[3-(2-fluorophenyl)prop-2-enoylamino]propanoic acid |
|---|---|
| PubChem CID | 78972924 |
| Molecular Formula | C12H12FNO3 |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | (2R)-2-[3-(2-fluorophenyl)prop-2-enoylamino]propanoic acid |
| SMILES | C[C@@H](NC(=O)C=Cc1ccccc1F)C(=O)O |
| InChI | InChI=1S/C12H12FNO3/c1-8(12(16)17)14-11(15)7-6-9-4-2-3-5-10(9)13/h2-8H,1H3,(H,14,15)(H,16,17)/t8-/m1/s1 |
| InChIKey | GJFJVDHIJIWISP-MRVPVSSYSA-N |
| XLogP | 1.43 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|