C14H14FNO5 — CID 60657043
2-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]pentanedioic acid (PubChem CID 60657043) has the molecular formula C14H14FNO5 and a molecular weight of 295.27 g/mol. Its IUPAC name is 2-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]pentanedioic acid.
| Compound Name | 2-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 60657043 |
| Molecular Formula | C14H14FNO5 |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 2-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)/C=C/c1ccccc1F)C(=O)O |
| InChI | InChI=1S/C14H14FNO5/c15-10-4-2-1-3-9(10)5-7-12(17)16-11(14(20)21)6-8-13(18)19/h1-5,7,11H,6,8H2,(H,16,17)(H,18,19)(H,20,21)/b7-5+ |
| InChIKey | GSPSSKILRRLNFA-FNORWQNLSA-N |
| XLogP | 1.27 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|