C13H12FNO5 — CID 78910331
2-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]butanedioic acid (PubChem CID 78910331) has the molecular formula C13H12FNO5 and a molecular weight of 281.24 g/mol. Its IUPAC name is 2-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]butanedioic acid.
| Compound Name | 2-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 78910331 |
| Molecular Formula | C13H12FNO5 |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 2-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]butanedioic acid |
| SMILES | O=C(O)CC(NC(=O)/C=C/c1ccccc1F)C(=O)O |
| InChI | InChI=1S/C13H12FNO5/c14-9-4-2-1-3-8(9)5-6-11(16)15-10(13(19)20)7-12(17)18/h1-6,10H,7H2,(H,15,16)(H,17,18)(H,19,20)/b6-5+ |
| InChIKey | CVIXJUMRABJMRR-AATRIKPKSA-N |
| XLogP | 0.88 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|