C13H14FNO4 — CID 9277808
methyl (2R)-2-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]-3-hydroxypropanoate (PubChem CID 9277808) has the molecular formula C13H14FNO4 and a molecular weight of 267.26 g/mol. Its IUPAC name is methyl (2R)-2-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]-3-hydroxypropanoate.
| Compound Name | methyl (2R)-2-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 9277808 |
| Molecular Formula | C13H14FNO4 |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | methyl (2R)-2-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]-3-hydroxypropanoate |
| SMILES | COC(=O)[C@@H](CO)NC(=O)/C=C/c1ccccc1F |
| InChI | InChI=1S/C13H14FNO4/c1-19-13(18)11(8-16)15-12(17)7-6-9-4-2-3-5-10(9)14/h2-7,11,16H,8H2,1H3,(H,15,17)/b7-6+/t11-/m1/s1 |
| InChIKey | ONINSBXLRVXQLU-XUIVZRPNSA-N |
| XLogP | 0.49 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|