C17H16FNO5 — CID 9278098
methyl (2R)-2-[[(E)-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enoyl]amino]-3-hydroxypropanoate (PubChem CID 9278098) has the molecular formula C17H16FNO5 and a molecular weight of 333.32 g/mol. Its IUPAC name is methyl (2R)-2-[[(E)-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enoyl]amino]-3-hydroxypropanoate.
| Compound Name | methyl (2R)-2-[[(E)-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enoyl]amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 9278098 |
| Molecular Formula | C17H16FNO5 |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | methyl (2R)-2-[[(E)-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enoyl]amino]-3-hydroxypropanoate |
| SMILES | COC(=O)[C@@H](CO)NC(=O)/C=C/c1ccc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C17H16FNO5/c1-23-17(22)14(10-20)19-16(21)9-7-11-6-8-15(24-11)12-4-2-3-5-13(12)18/h2-9,14,20H,10H2,1H3,(H,19,21)/b9-7+/t14-/m1/s1 |
| InChIKey | LJFBHXCYUBEJEJ-RCQQVGEISA-N |
| XLogP | 1.75 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|