C19H17FN4O2 — CID 71899302
N'-(4,6-dimethylpyrimidin-2-yl)-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enehydrazide (PubChem CID 71899302) has the molecular formula C19H17FN4O2 and a molecular weight of 352.37 g/mol. Its IUPAC name is N'-(4,6-dimethylpyrimidin-2-yl)-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enehydrazide.
| Compound Name | N'-(4,6-dimethylpyrimidin-2-yl)-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 71899302 |
| Molecular Formula | C19H17FN4O2 |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | N'-(4,6-dimethylpyrimidin-2-yl)-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enehydrazide |
| SMILES | Cc1cc(C)nc(NNC(=O)C=Cc2ccc(-c3ccccc3F)o2)n1 |
| InChI | InChI=1S/C19H17FN4O2/c1-12-11-13(2)22-19(21-12)24-23-18(25)10-8-14-7-9-17(26-14)15-5-3-4-6-16(15)20/h3-11H,1-2H3,(H,23,25)(H,21,22,24) |
| InChIKey | LPIHESUXWDNIBA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|