C24H23FN2O2 — CID 27041698
(E)-3-[5-(2-fluorophenyl)furan-2-yl]-1-[4-(3-methylphenyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 27041698) has the molecular formula C24H23FN2O2 and a molecular weight of 390.46 g/mol. Its IUPAC name is (E)-3-[5-(2-fluorophenyl)furan-2-yl]-1-[4-(3-methylphenyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-[5-(2-fluorophenyl)furan-2-yl]-1-[4-(3-methylphenyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 27041698 |
| Molecular Formula | C24H23FN2O2 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (E)-3-[5-(2-fluorophenyl)furan-2-yl]-1-[4-(3-methylphenyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | Cc1cccc(N2CCN(C(=O)/C=C/c3ccc(-c4ccccc4F)o3)CC2)c1 |
| InChI | InChI=1S/C24H23FN2O2/c1-18-5-4-6-19(17-18)26-13-15-27(16-14-26)24(28)12-10-20-9-11-23(29-20)21-7-2-3-8-22(21)25/h2-12,17H,13-16H2,1H3/b12-10+ |
| InChIKey | SZPNXFYBEMYITK-ZRDIBKRKSA-N |
| XLogP | 4.76 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|