C15H18N2O3 — CID 57367851
4-[4-(3-methylphenyl)piperazin-1-yl]-4-oxobut-2-enoic acid (PubChem CID 57367851) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 4-[4-(3-methylphenyl)piperazin-1-yl]-4-oxobut-2-enoic acid.
| Compound Name | 4-[4-(3-methylphenyl)piperazin-1-yl]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 57367851 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 4-[4-(3-methylphenyl)piperazin-1-yl]-4-oxobut-2-enoic acid |
| SMILES | Cc1cccc(N2CCN(C(=O)C=CC(=O)O)CC2)c1 |
| InChI | InChI=1S/C15H18N2O3/c1-12-3-2-4-13(11-12)16-7-9-17(10-8-16)14(18)5-6-15(19)20/h2-6,11H,7-10H2,1H3,(H,19,20) |
| InChIKey | NGDCVDBVBZSNDD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|