C19H26N4O3 — CID 108508453
1-(4-acetylpiperazin-1-yl)-2-[4-(3-methylphenyl)piperazin-1-yl]ethane-1,2-dione (PubChem CID 108508453) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is 1-(4-acetylpiperazin-1-yl)-2-[4-(3-methylphenyl)piperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-(4-acetylpiperazin-1-yl)-2-[4-(3-methylphenyl)piperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 108508453 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 1-(4-acetylpiperazin-1-yl)-2-[4-(3-methylphenyl)piperazin-1-yl]ethane-1,2-dione |
| SMILES | CC(=O)N1CCN(C(=O)C(=O)N2CCN(c3cccc(C)c3)CC2)CC1 |
| InChI | InChI=1S/C19H26N4O3/c1-15-4-3-5-17(14-15)21-8-12-23(13-9-21)19(26)18(25)22-10-6-20(7-11-22)16(2)24/h3-5,14H,6-13H2,1-2H3 |
| InChIKey | LDUVZNKNCSDJLQ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|