C20H29N3O2 — CID 108520633
1-(3,5-dimethylpiperidin-1-yl)-2-[4-(3-methylphenyl)piperazin-1-yl]ethane-1,2-dione (PubChem CID 108520633) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 1-(3,5-dimethylpiperidin-1-yl)-2-[4-(3-methylphenyl)piperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-(3,5-dimethylpiperidin-1-yl)-2-[4-(3-methylphenyl)piperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 108520633 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 1-(3,5-dimethylpiperidin-1-yl)-2-[4-(3-methylphenyl)piperazin-1-yl]ethane-1,2-dione |
| SMILES | Cc1cccc(N2CCN(C(=O)C(=O)N3CC(C)CC(C)C3)CC2)c1 |
| InChI | InChI=1S/C20H29N3O2/c1-15-5-4-6-18(12-15)21-7-9-22(10-8-21)19(24)20(25)23-13-16(2)11-17(3)14-23/h4-6,12,16-17H,7-11,13-14H2,1-3H3 |
| InChIKey | JWCYRSJLLHNLIS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|