C23H22BrN3O2 — CID 132591144
(E)-3-[5-(4-amino-2-bromophenyl)furan-2-yl]-1-(4-phenylpiperazin-1-yl)prop-2-en-1-one (PubChem CID 132591144) has the molecular formula C23H22BrN3O2 and a molecular weight of 452.35 g/mol. Its IUPAC name is (E)-3-[5-(4-amino-2-bromophenyl)furan-2-yl]-1-(4-phenylpiperazin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-(4-amino-2-bromophenyl)furan-2-yl]-1-(4-phenylpiperazin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 132591144 |
| Molecular Formula | C23H22BrN3O2 |
| Molecular Weight | 452.35 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | (E)-3-[5-(4-amino-2-bromophenyl)furan-2-yl]-1-(4-phenylpiperazin-1-yl)prop-2-en-1-one |
| SMILES | Nc1ccc(-c2ccc(/C=C/C(=O)N3CCN(c4ccccc4)CC3)o2)c(Br)c1 |
| InChI | InChI=1S/C23H22BrN3O2/c24-21-16-17(25)6-9-20(21)22-10-7-19(29-22)8-11-23(28)27-14-12-26(13-15-27)18-4-2-1-3-5-18/h1-11,16H,12-15,25H2/b11-8+ |
| InChIKey | NURHZKIKPWOVEF-DHZHZOJOSA-N |
| XLogP | 4.65 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.35 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|