C20H15Br3N2O2 — CID 100828433
(E)-N-(4-amino-2-bromo-6-methylphenyl)-3-[5-(2,4-dibromophenyl)furan-2-yl]prop-2-enamide (PubChem CID 100828433) has the molecular formula C20H15Br3N2O2 and a molecular weight of 555.06 g/mol. Its IUPAC name is (E)-N-(4-amino-2-bromo-6-methylphenyl)-3-[5-(2,4-dibromophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-(4-amino-2-bromo-6-methylphenyl)-3-[5-(2,4-dibromophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 100828433 |
| Molecular Formula | C20H15Br3N2O2 |
| Molecular Weight | 555.06 g/mol |
| Exact Mass | 551.87 |
| IUPAC Name | (E)-N-(4-amino-2-bromo-6-methylphenyl)-3-[5-(2,4-dibromophenyl)furan-2-yl]prop-2-enamide |
| SMILES | Cc1cc(N)cc(Br)c1NC(=O)/C=C/c1ccc(-c2ccc(Br)cc2Br)o1 |
| InChI | InChI=1S/C20H15Br3N2O2/c1-11-8-13(24)10-17(23)20(11)25-19(26)7-4-14-3-6-18(27-14)15-5-2-12(21)9-16(15)22/h2-10H,24H2,1H3,(H,25,26)/b7-4+ |
| InChIKey | LXRWOXVRGPWYCR-QPJJXVBHSA-N |
| XLogP | 6.78 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.06 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|