C18H13Br2ClN2O2 — CID 100816695
N-(4-amino-2-bromo-6-methylphenyl)-5-(2-bromo-4-chlorophenyl)furan-2-carboxamide (PubChem CID 100816695) has the molecular formula C18H13Br2ClN2O2 and a molecular weight of 484.58 g/mol. Its IUPAC name is N-(4-amino-2-bromo-6-methylphenyl)-5-(2-bromo-4-chlorophenyl)furan-2-carboxamide.
| Compound Name | N-(4-amino-2-bromo-6-methylphenyl)-5-(2-bromo-4-chlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 100816695 |
| Molecular Formula | C18H13Br2ClN2O2 |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 481.90 |
| IUPAC Name | N-(4-amino-2-bromo-6-methylphenyl)-5-(2-bromo-4-chlorophenyl)furan-2-carboxamide |
| SMILES | Cc1cc(N)cc(Br)c1NC(=O)c1ccc(-c2ccc(Cl)cc2Br)o1 |
| InChI | InChI=1S/C18H13Br2ClN2O2/c1-9-6-11(22)8-14(20)17(9)23-18(24)16-5-4-15(25-16)12-3-2-10(21)7-13(12)19/h2-8H,22H2,1H3,(H,23,24) |
| InChIKey | NZZWXYFVXNRRNX-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|