C19H17BrN2O2 — CID 100817322
N-(3-amino-4-methylphenyl)-5-(2-bromo-4-methylphenyl)furan-2-carboxamide (PubChem CID 100817322) has the molecular formula C19H17BrN2O2 and a molecular weight of 385.26 g/mol. Its IUPAC name is N-(3-amino-4-methylphenyl)-5-(2-bromo-4-methylphenyl)furan-2-carboxamide.
| Compound Name | N-(3-amino-4-methylphenyl)-5-(2-bromo-4-methylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 100817322 |
| Molecular Formula | C19H17BrN2O2 |
| Molecular Weight | 385.26 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | N-(3-amino-4-methylphenyl)-5-(2-bromo-4-methylphenyl)furan-2-carboxamide |
| SMILES | Cc1ccc(-c2ccc(C(=O)Nc3ccc(C)c(N)c3)o2)c(Br)c1 |
| InChI | InChI=1S/C19H17BrN2O2/c1-11-3-6-14(15(20)9-11)17-7-8-18(24-17)19(23)22-13-5-4-12(2)16(21)10-13/h3-10H,21H2,1-2H3,(H,22,23) |
| InChIKey | HKKQDGAGUVAVKI-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.26 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|